C14H9N3O4 — CID 54695908
4-hydroxy-2-oxo-N-pyrimidin-2-ylchromene-3-carboxamide (PubChem CID 54695908) has the molecular formula C14H9N3O4 and a molecular weight of 283.24 g/mol. Its IUPAC name is 4-hydroxy-2-oxo-N-pyrimidin-2-ylchromene-3-carboxamide.
| Compound Name | 4-hydroxy-2-oxo-N-pyrimidin-2-ylchromene-3-carboxamide |
|---|---|
| PubChem CID | 54695908 |
| Molecular Formula | C14H9N3O4 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-hydroxy-2-oxo-N-pyrimidin-2-ylchromene-3-carboxamide |
| SMILES | O=C(Nc1ncccn1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C14H9N3O4/c18-11-8-4-1-2-5-9(8)21-13(20)10(11)12(19)17-14-15-6-3-7-16-14/h1-7,18H,(H,15,16,17,19) |
| InChIKey | DHZHLVCECPOTKS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|