C16H9F2NO4 — CID 54737498
N-(2,4-difluorophenyl)-4-hydroxy-2-oxochromene-3-carboxamide (PubChem CID 54737498) has the molecular formula C16H9F2NO4 and a molecular weight of 317.25 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-hydroxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-4-hydroxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 54737498 |
| Molecular Formula | C16H9F2NO4 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-hydroxy-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C16H9F2NO4/c17-8-5-6-11(10(18)7-8)19-15(21)13-14(20)9-3-1-2-4-12(9)23-16(13)22/h1-7,20H,(H,19,21) |
| InChIKey | XHOVSZSTEGLCEO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|