C20H12F4N2O2 — CID 4062467
1-N,2-N-bis(2,4-difluorophenyl)benzene-1,2-dicarboxamide (PubChem CID 4062467) has the molecular formula C20H12F4N2O2 and a molecular weight of 388.32 g/mol. Its IUPAC name is 1-N,2-N-bis(2,4-difluorophenyl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis(2,4-difluorophenyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 4062467 |
| Molecular Formula | C20H12F4N2O2 |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 1-N,2-N-bis(2,4-difluorophenyl)benzene-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1ccccc1C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H12F4N2O2/c21-11-5-7-17(15(23)9-11)25-19(27)13-3-1-2-4-14(13)20(28)26-18-8-6-12(22)10-16(18)24/h1-10H,(H,25,27)(H,26,28) |
| InChIKey | JIROOQMFEZFGFZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |