C14H11F2NO3S — CID 7565548
N-(2,4-difluorophenyl)-2-methylsulfonylbenzamide (PubChem CID 7565548) has the molecular formula C14H11F2NO3S and a molecular weight of 311.31 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-methylsulfonylbenzamide.
| Compound Name | N-(2,4-difluorophenyl)-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 7565548 |
| Molecular Formula | C14H11F2NO3S |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H11F2NO3S/c1-21(19,20)13-5-3-2-4-10(13)14(18)17-12-7-6-9(15)8-11(12)16/h2-8H,1H3,(H,17,18) |
| InChIKey | VWICFGYCEUOZNQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |