C17H15F2NO5S — CID 8976575
[(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate (PubChem CID 8976575) has the molecular formula C17H15F2NO5S and a molecular weight of 383.37 g/mol. Its IUPAC name is [(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate.
| Compound Name | [(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 8976575 |
| Molecular Formula | C17H15F2NO5S |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | [(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1S(C)(=O)=O)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H15F2NO5S/c1-10(16(21)20-14-8-7-11(18)9-13(14)19)25-17(22)12-5-3-4-6-15(12)26(2,23)24/h3-10H,1-2H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | CKVLZRAVIBHWIQ-SNVBAGLBSA-N |
| XLogP | 2.55 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |