C18H18ClNO5S — CID 18091804
[1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate (PubChem CID 18091804) has the molecular formula C18H18ClNO5S and a molecular weight of 395.86 g/mol. Its IUPAC name is [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate.
| Compound Name | [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18091804 |
| Molecular Formula | C18H18ClNO5S |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(C)OC(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C18H18ClNO5S/c1-11-8-9-13(19)10-15(11)20-17(21)12(2)25-18(22)14-6-4-5-7-16(14)26(3,23)24/h4-10,12H,1-3H3,(H,20,21) |
| InChIKey | JYDCFKQPEYWYRX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |