C25H19ClN2O5 — CID 46619841
[1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 1-amino-9,10-dioxoanthracene-2-carboxylate (PubChem CID 46619841) has the molecular formula C25H19ClN2O5 and a molecular weight of 462.89 g/mol. Its IUPAC name is [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 1-amino-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 1-amino-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 46619841 |
| Molecular Formula | C25H19ClN2O5 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 1-amino-9,10-dioxoanthracene-2-carboxylate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(C)OC(=O)c1ccc2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H19ClN2O5/c1-12-7-8-14(26)11-19(12)28-24(31)13(2)33-25(32)18-10-9-17-20(21(18)27)23(30)16-6-4-3-5-15(16)22(17)29/h3-11,13H,27H2,1-2H3,(H,28,31) |
| InChIKey | KZRMBZSIMFDEHF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|