C25H20N2O5 — CID 55319065
[1-(3-methylanilino)-1-oxopropan-2-yl] 1-amino-9,10-dioxoanthracene-2-carboxylate (PubChem CID 55319065) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is [1-(3-methylanilino)-1-oxopropan-2-yl] 1-amino-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [1-(3-methylanilino)-1-oxopropan-2-yl] 1-amino-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 55319065 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [1-(3-methylanilino)-1-oxopropan-2-yl] 1-amino-9,10-dioxoanthracene-2-carboxylate |
| SMILES | Cc1cccc(NC(=O)C(C)OC(=O)c2ccc3c(c2N)C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C25H20N2O5/c1-13-6-5-7-15(12-13)27-24(30)14(2)32-25(31)19-11-10-18-20(21(19)26)23(29)17-9-4-3-8-16(17)22(18)28/h3-12,14H,26H2,1-2H3,(H,27,30) |
| InChIKey | WCBYNCYWYBOERD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|