C24H14ClF2NO5 — CID 55417486
[1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 55417486) has the molecular formula C24H14ClF2NO5 and a molecular weight of 469.83 g/mol. Its IUPAC name is [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 55417486 |
| Molecular Formula | C24H14ClF2NO5 |
| Molecular Weight | 469.83 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C24H14ClF2NO5/c1-11(23(31)28-18-10-12(26)6-9-17(18)27)33-24(32)16-8-7-15-19(20(16)25)22(30)14-5-3-2-4-13(14)21(15)29/h2-11H,1H3,(H,28,31) |
| InChIKey | NUFHILZRXJUPHO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|