C20H15ClN2O6 — CID 7980488
[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 7980488) has the molecular formula C20H15ClN2O6 and a molecular weight of 414.80 g/mol. Its IUPAC name is [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 7980488 |
| Molecular Formula | C20H15ClN2O6 |
| Molecular Weight | 414.80 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CNC(=O)NC(=O)[C@@H](C)OC(=O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H15ClN2O6/c1-9(18(26)23-20(28)22-2)29-19(27)13-8-7-12-14(15(13)21)17(25)11-6-4-3-5-10(11)16(12)24/h3-9H,1-2H3,(H2,22,23,26,28)/t9-/m1/s1 |
| InChIKey | JVVZZIXMLMJLQD-SECBINFHSA-N |
| XLogP | 2.12 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.80 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|