C29H17ClO5 — CID 97081046
[(1S)-2-oxo-1,2-diphenylethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 97081046) has the molecular formula C29H17ClO5 and a molecular weight of 480.90 g/mol. Its IUPAC name is [(1S)-2-oxo-1,2-diphenylethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [(1S)-2-oxo-1,2-diphenylethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 97081046 |
| Molecular Formula | C29H17ClO5 |
| Molecular Weight | 480.90 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | [(1S)-2-oxo-1,2-diphenylethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C(O[C@H](C(=O)c1ccccc1)c1ccccc1)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H17ClO5/c30-24-22(16-15-21-23(24)27(33)20-14-8-7-13-19(20)26(21)32)29(34)35-28(18-11-5-2-6-12-18)25(31)17-9-3-1-4-10-17/h1-16,28H/t28-/m0/s1 |
| InChIKey | XZIBCJKEAMMXOM-NDEPHWFRSA-N |
| XLogP | 5.90 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.90 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|