C19H15ClO5 — CID 55354845
2-ethoxyethyl 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 55354845) has the molecular formula C19H15ClO5 and a molecular weight of 358.78 g/mol. Its IUPAC name is 2-ethoxyethyl 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | 2-ethoxyethyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 55354845 |
| Molecular Formula | C19H15ClO5 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-ethoxyethyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCOCCOC(=O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H15ClO5/c1-2-24-9-10-25-19(23)14-8-7-13-15(16(14)20)18(22)12-6-4-3-5-11(12)17(13)21/h3-8H,2,9-10H2,1H3 |
| InChIKey | KPPGFVYJRKTMDF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|