C23H14ClFO5 — CID 55313632
(5-fluoro-2-methoxyphenyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 55313632) has the molecular formula C23H14ClFO5 and a molecular weight of 424.81 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (5-fluoro-2-methoxyphenyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 55313632 |
| Molecular Formula | C23H14ClFO5 |
| Molecular Weight | 424.81 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | COc1ccc(F)cc1COC(=O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H14ClFO5/c1-29-18-9-6-13(25)10-12(18)11-30-23(28)17-8-7-16-19(20(17)24)22(27)15-5-3-2-4-14(15)21(16)26/h2-10H,11H2,1H3 |
| InChIKey | BHBODYOIFPOPBG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|