C22H17ClN2O5 — CID 55522681
[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 55522681) has the molecular formula C22H17ClN2O5 and a molecular weight of 424.84 g/mol. Its IUPAC name is [3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 55522681 |
| Molecular Formula | C22H17ClN2O5 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | [3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(C)Cc1noc(COC(=O)c2ccc3c(c2Cl)C(=O)c2ccccc2C3=O)n1 |
| InChI | InChI=1S/C22H17ClN2O5/c1-11(2)9-16-24-17(30-25-16)10-29-22(28)15-8-7-14-18(19(15)23)21(27)13-6-4-3-5-12(13)20(14)26/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | BYQFSXPBBBOBLV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|