C14H14ClN3O5 — CID 24631218
[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 5-chloro-2-nitrobenzoate (PubChem CID 24631218) has the molecular formula C14H14ClN3O5 and a molecular weight of 339.74 g/mol. Its IUPAC name is [3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 5-chloro-2-nitrobenzoate.
| Compound Name | [3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 24631218 |
| Molecular Formula | C14H14ClN3O5 |
| Molecular Weight | 339.74 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | [3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 5-chloro-2-nitrobenzoate |
| SMILES | CC(C)Cc1noc(COC(=O)c2cc(Cl)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H14ClN3O5/c1-8(2)5-12-16-13(23-17-12)7-22-14(19)10-6-9(15)3-4-11(10)18(20)21/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | GHWGLEAGWVYXOZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|