C12H10ClN3O5 — CID 18165757
(5-ethyl-1,3,4-oxadiazol-2-yl)methyl 5-chloro-2-nitrobenzoate (PubChem CID 18165757) has the molecular formula C12H10ClN3O5 and a molecular weight of 311.68 g/mol. Its IUPAC name is (5-ethyl-1,3,4-oxadiazol-2-yl)methyl 5-chloro-2-nitrobenzoate.
| Compound Name | (5-ethyl-1,3,4-oxadiazol-2-yl)methyl 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 18165757 |
| Molecular Formula | C12H10ClN3O5 |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | (5-ethyl-1,3,4-oxadiazol-2-yl)methyl 5-chloro-2-nitrobenzoate |
| SMILES | CCc1nnc(COC(=O)c2cc(Cl)ccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H10ClN3O5/c1-2-10-14-15-11(21-10)6-20-12(17)8-5-7(13)3-4-9(8)16(18)19/h3-5H,2,6H2,1H3 |
| InChIKey | URZABQRXNFCNKC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|