C18H14ClN3O6 — CID 9372975
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxy-3-nitrobenzoate (PubChem CID 9372975) has the molecular formula C18H14ClN3O6 and a molecular weight of 403.78 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxy-3-nitrobenzoate.
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 9372975 |
| Molecular Formula | C18H14ClN3O6 |
| Molecular Weight | 403.78 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-ethoxy-3-nitrobenzoate |
| SMILES | CCOc1ccc(C(=O)OCc2nnc(-c3ccc(Cl)cc3)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14ClN3O6/c1-2-26-15-8-5-12(9-14(15)22(24)25)18(23)27-10-16-20-21-17(28-16)11-3-6-13(19)7-4-11/h3-9H,2,10H2,1H3 |
| InChIKey | NSWFGOUVHYITDM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|