C19H17N5O8 — CID 55403913
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-(2-methoxyethylamino)-3-nitrobenzoate (PubChem CID 55403913) has the molecular formula C19H17N5O8 and a molecular weight of 443.37 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-(2-methoxyethylamino)-3-nitrobenzoate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-(2-methoxyethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 55403913 |
| Molecular Formula | C19H17N5O8 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-(2-methoxyethylamino)-3-nitrobenzoate |
| SMILES | COCCNc1ccc(C(=O)OCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17N5O8/c1-30-9-8-20-15-7-4-13(10-16(15)24(28)29)19(25)31-11-17-21-22-18(32-17)12-2-5-14(6-3-12)23(26)27/h2-7,10,20H,8-9,11H2,1H3 |
| InChIKey | RKQNMMJYUJBAPU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 172.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|