C17H11N3O6 — CID 7669153
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-formylbenzoate (PubChem CID 7669153) has the molecular formula C17H11N3O6 and a molecular weight of 353.29 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-formylbenzoate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-formylbenzoate |
|---|---|
| PubChem CID | 7669153 |
| Molecular Formula | C17H11N3O6 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)cc1 |
| InChI | InChI=1S/C17H11N3O6/c21-9-11-1-3-13(4-2-11)17(22)25-10-15-18-19-16(26-15)12-5-7-14(8-6-12)20(23)24/h1-9H,10H2 |
| InChIKey | SMKJJHHMIFXNOV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 125.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|