C20H18N4O9 — CID 55442211
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-(2-amino-2-oxoethoxy)-3,5-dimethoxybenzoate (PubChem CID 55442211) has the molecular formula C20H18N4O9 and a molecular weight of 458.38 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-(2-amino-2-oxoethoxy)-3,5-dimethoxybenzoate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-(2-amino-2-oxoethoxy)-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 55442211 |
| Molecular Formula | C20H18N4O9 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-(2-amino-2-oxoethoxy)-3,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C20H18N4O9/c1-29-14-7-12(8-15(30-2)18(14)31-9-16(21)25)20(26)32-10-17-22-23-19(33-17)11-3-5-13(6-4-11)24(27)28/h3-8H,9-10H2,1-2H3,(H2,21,25) |
| InChIKey | DVLYGIQHGOMCGR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 179.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|