C19H17N3O6 — CID 8527861
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(2,6-dimethylphenoxy)acetate (PubChem CID 8527861) has the molecular formula C19H17N3O6 and a molecular weight of 383.36 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(2,6-dimethylphenoxy)acetate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 8527861 |
| Molecular Formula | C19H17N3O6 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(2,6-dimethylphenoxy)acetate |
| SMILES | Cc1cccc(C)c1OCC(=O)OCc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C19H17N3O6/c1-12-4-3-5-13(2)18(12)27-11-17(23)26-10-16-20-21-19(28-16)14-6-8-15(9-7-14)22(24)25/h3-9H,10-11H2,1-2H3 |
| InChIKey | XJCXAKQLSWLXPT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|