C18H15N3O5S — CID 46266347
(2,6-dimethylphenyl) 2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (PubChem CID 46266347) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
| Compound Name | (2,6-dimethylphenyl) 2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 46266347 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (2,6-dimethylphenyl) 2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| SMILES | Cc1cccc(C)c1OC(=O)CSc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C18H15N3O5S/c1-11-4-3-5-12(2)16(11)25-15(22)10-27-18-20-19-17(26-18)13-6-8-14(9-7-13)21(23)24/h3-9H,10H2,1-2H3 |
| InChIKey | HVZLWJKWBNGNPP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|