C19H14N4O5 — CID 7663974
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(1H-indol-3-yl)acetate (PubChem CID 7663974) has the molecular formula C19H14N4O5 and a molecular weight of 378.34 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(1H-indol-3-yl)acetate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7663974 |
| Molecular Formula | C19H14N4O5 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)OCc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C19H14N4O5/c24-18(9-13-10-20-16-4-2-1-3-15(13)16)27-11-17-21-22-19(28-17)12-5-7-14(8-6-12)23(25)26/h1-8,10,20H,9,11H2 |
| InChIKey | YDQATQHGTNPGHW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|