C18H14N2O3 — CID 40735475
1,3-benzoxazol-2-ylmethyl 2-(1H-indol-3-yl)acetate (PubChem CID 40735475) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 2-(1H-indol-3-yl)acetate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 40735475 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)OCc1nc2ccccc2o1 |
| InChI | InChI=1S/C18H14N2O3/c21-18(9-12-10-19-14-6-2-1-5-13(12)14)22-11-17-20-15-7-3-4-8-16(15)23-17/h1-8,10,19H,9,11H2 |
| InChIKey | WGFWZACGIGRWFO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |