C17H14N2O4 — CID 40734432
1,3-benzoxazol-2-ylmethyl 2-benzamidoacetate (PubChem CID 40734432) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 2-benzamidoacetate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl 2-benzamidoacetate |
|---|---|
| PubChem CID | 40734432 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl 2-benzamidoacetate |
| SMILES | O=C(CNC(=O)c1ccccc1)OCc1nc2ccccc2o1 |
| InChI | InChI=1S/C17H14N2O4/c20-16(10-18-17(21)12-6-2-1-3-7-12)22-11-15-19-13-8-4-5-9-14(13)23-15/h1-9H,10-11H2,(H,18,21) |
| InChIKey | RHLAQGCMUOKJPC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |