C17H15N3O4 — CID 71938022
1,3-benzoxazol-2-ylmethyl 4-[(2-amino-2-oxoethyl)amino]benzoate (PubChem CID 71938022) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 4-[(2-amino-2-oxoethyl)amino]benzoate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl 4-[(2-amino-2-oxoethyl)amino]benzoate |
|---|---|
| PubChem CID | 71938022 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl 4-[(2-amino-2-oxoethyl)amino]benzoate |
| SMILES | NC(=O)CNc1ccc(C(=O)OCc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C17H15N3O4/c18-15(21)9-19-12-7-5-11(6-8-12)17(22)23-10-16-20-13-3-1-2-4-14(13)24-16/h1-8,19H,9-10H2,(H2,18,21) |
| InChIKey | UAJIWEVECNGJPE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |