C16H11F2NO4 — CID 18192162
1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate (PubChem CID 18192162) has the molecular formula C16H11F2NO4 and a molecular weight of 319.26 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 18192162 |
| Molecular Formula | C16H11F2NO4 |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate |
| SMILES | O=C(OCc1nc2ccccc2o1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H11F2NO4/c17-16(18)23-12-7-3-1-5-10(12)15(20)21-9-14-19-11-6-2-4-8-13(11)22-14/h1-8,16H,9H2 |
| InChIKey | ZLHOSKTZFKQPRU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |