1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate

C16H11F2NO4 — CID 18192162

IUPAC1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate
SMILESO=C(OCc1nc2ccccc2o1)c1ccccc1OC(F)F
InChIInChI=1S/C16H11F2NO4/c17-16(18)23-12-7-3-1-5-10(12)15(20)21-9-14-19-11-6-2-4-8-13(11)22-14/h1-8,16H,9H2
InChIKeyZLHOSKTZFKQPRU-UHFFFAOYSA-N
MW319.26 g/mol
LogP3.79
Rot. Bonds5

About 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate

1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate (PubChem CID 18192162) has the molecular formula C16H11F2NO4 and a molecular weight of 319.26 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate.

Molecular Properties

Compound Name1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate
PubChem CID18192162
Molecular FormulaC16H11F2NO4
Molecular Weight319.26 g/mol
Exact Mass319.07
IUPAC Name1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate
SMILESO=C(OCc1nc2ccccc2o1)c1ccccc1OC(F)F
InChIInChI=1S/C16H11F2NO4/c17-16(18)23-12-7-3-1-5-10(12)15(20)21-9-14-19-11-6-2-4-8-13(11)22-14/h1-8,16H,9H2
InChIKeyZLHOSKTZFKQPRU-UHFFFAOYSA-N
XLogP3.79
TPSA61.56 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.26
LogP ≤ 53.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate?
The IUPAC name of 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate (CID 18192162) is 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate.
What is the SMILES notation for 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate?
The canonical SMILES for 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate is O=C(OCc1nc2ccccc2o1)c1ccccc1OC(F)F.
What is the InChIKey of 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate?
The InChIKey is ZLHOSKTZFKQPRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F2NO4/c17-16(18)23-12-7-3-1-5-10(12)15(20)21-9-14-19-11-6-2-4-8-13(11)22-14/h1-8,16H,9H2.
What are the key properties of 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate?
1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate has a molecular weight of 319.26 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzoxazol-2-ylmethyl 2-(difluoromethoxy)benzoate is sourced from PubChem (CID 18192162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).