C18H13F2NO3S — CID 55327358
(2-phenyl-1,3-thiazol-4-yl)methyl 2-(difluoromethoxy)benzoate (PubChem CID 55327358) has the molecular formula C18H13F2NO3S and a molecular weight of 361.37 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 2-(difluoromethoxy)benzoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 55327358 |
| Molecular Formula | C18H13F2NO3S |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-(difluoromethoxy)benzoate |
| SMILES | O=C(OCc1csc(-c2ccccc2)n1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C18H13F2NO3S/c19-18(20)24-15-9-5-4-8-14(15)17(22)23-10-13-11-25-16(21-13)12-6-2-1-3-7-12/h1-9,11,18H,10H2 |
| InChIKey | AMAVUQRMINQTPV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |