C20H19NO4S — CID 4857964
(2-phenyl-1,3-thiazol-4-yl)methyl 3,5-dimethoxy-4-methylbenzoate (PubChem CID 4857964) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 3,5-dimethoxy-4-methylbenzoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3,5-dimethoxy-4-methylbenzoate |
|---|---|
| PubChem CID | 4857964 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3,5-dimethoxy-4-methylbenzoate |
| SMILES | COc1cc(C(=O)OCc2csc(-c3ccccc3)n2)cc(OC)c1C |
| InChI | InChI=1S/C20H19NO4S/c1-13-17(23-2)9-15(10-18(13)24-3)20(22)25-11-16-12-26-19(21-16)14-7-5-4-6-8-14/h4-10,12H,11H2,1-3H3 |
| InChIKey | AUJAHVQEUMJIIV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |