C20H19NO5S — CID 16523605
[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3,5-dimethoxybenzoate (PubChem CID 16523605) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3,5-dimethoxybenzoate.
| Compound Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 16523605 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCc2csc(-c3ccccc3OC)n2)c1 |
| InChI | InChI=1S/C20H19NO5S/c1-23-15-8-13(9-16(10-15)24-2)20(22)26-11-14-12-27-19(21-14)17-6-4-5-7-18(17)25-3/h4-10,12H,11H2,1-3H3 |
| InChIKey | QPEWATSCPUQPAP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |