C21H21NO6S — CID 16522456
[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3,4,5-trimethoxybenzoate (PubChem CID 16522456) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3,4,5-trimethoxybenzoate.
| Compound Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 16522456 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1ccccc1-c1nc(COC(=O)c2cc(OC)c(OC)c(OC)c2)cs1 |
| InChI | InChI=1S/C21H21NO6S/c1-24-16-8-6-5-7-15(16)20-22-14(12-29-20)11-28-21(23)13-9-17(25-2)19(27-4)18(10-13)26-3/h5-10,12H,11H2,1-4H3 |
| InChIKey | VGVQJGSHLGEKPO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |