C17H13ClN2O3S — CID 38230614
[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-4-carboxylate (PubChem CID 38230614) has the molecular formula C17H13ClN2O3S and a molecular weight of 360.82 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-4-carboxylate.
| Compound Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 38230614 |
| Molecular Formula | C17H13ClN2O3S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-4-carboxylate |
| SMILES | COc1ccccc1-c1nc(COC(=O)c2ccnc(Cl)c2)cs1 |
| InChI | InChI=1S/C17H13ClN2O3S/c1-22-14-5-3-2-4-13(14)16-20-12(10-24-16)9-23-17(21)11-6-7-19-15(18)8-11/h2-8,10H,9H2,1H3 |
| InChIKey | OAZGFNACKKMNGW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|