C20H17NO5S — CID 7670150
[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-formylbenzoate (PubChem CID 7670150) has the molecular formula C20H17NO5S and a molecular weight of 383.43 g/mol. Its IUPAC name is [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-formylbenzoate.
| Compound Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-formylbenzoate |
|---|---|
| PubChem CID | 7670150 |
| Molecular Formula | C20H17NO5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-formylbenzoate |
| SMILES | COc1cccc(-c2nc(COC(=O)c3ccc(C=O)cc3)cs2)c1OC |
| InChI | InChI=1S/C20H17NO5S/c1-24-17-5-3-4-16(18(17)25-2)19-21-15(12-27-19)11-26-20(23)14-8-6-13(10-22)7-9-14/h3-10,12H,11H2,1-2H3 |
| InChIKey | GQAFRGFABJPCOL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|