C27H22ClNO4S — CID 16509905
[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-2-(4-chlorophenyl)-3-phenylprop-2-enoate (PubChem CID 16509905) has the molecular formula C27H22ClNO4S and a molecular weight of 492.00 g/mol. Its IUPAC name is [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-2-(4-chlorophenyl)-3-phenylprop-2-enoate.
| Compound Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-2-(4-chlorophenyl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 16509905 |
| Molecular Formula | C27H22ClNO4S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-2-(4-chlorophenyl)-3-phenylprop-2-enoate |
| SMILES | COc1cccc(-c2nc(COC(=O)/C(=C/c3ccccc3)c3ccc(Cl)cc3)cs2)c1OC |
| InChI | InChI=1S/C27H22ClNO4S/c1-31-24-10-6-9-22(25(24)32-2)26-29-21(17-34-26)16-33-27(30)23(15-18-7-4-3-5-8-18)19-11-13-20(28)14-12-19/h3-15,17H,16H2,1-2H3/b23-15+ |
| InChIKey | ITZLBHQMROIDSF-HZHRSRAPSA-N |
| XLogP | 6.76 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|