C17H14N2O6S2 — CID 9364416
[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 5-nitrothiophene-2-carboxylate (PubChem CID 9364416) has the molecular formula C17H14N2O6S2 and a molecular weight of 406.44 g/mol. Its IUPAC name is [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 5-nitrothiophene-2-carboxylate.
| Compound Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 9364416 |
| Molecular Formula | C17H14N2O6S2 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 5-nitrothiophene-2-carboxylate |
| SMILES | COc1cccc(-c2nc(COC(=O)c3ccc([N+](=O)[O-])s3)cs2)c1OC |
| InChI | InChI=1S/C17H14N2O6S2/c1-23-12-5-3-4-11(15(12)24-2)16-18-10(9-26-16)8-25-17(20)13-6-7-14(27-13)19(21)22/h3-7,9H,8H2,1-2H3 |
| InChIKey | ZBZCMZXYKNUKKO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|