C18H16N2O5S2 — CID 7467913
(2-phenyl-1,3-thiazol-4-yl)methyl 2-methoxy-5-sulfamoylbenzoate (PubChem CID 7467913) has the molecular formula C18H16N2O5S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 7467913 |
| Molecular Formula | C18H16N2O5S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)OCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H16N2O5S2/c1-24-16-8-7-14(27(19,22)23)9-15(16)18(21)25-10-13-11-26-17(20-13)12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H2,19,22,23) |
| InChIKey | OSMIDAIYESJXMF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |