C19H19N3O5S2 — CID 16518384
[2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-methoxy-5-sulfamoylbenzoate (PubChem CID 16518384) has the molecular formula C19H19N3O5S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16518384 |
| Molecular Formula | C19H19N3O5S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)OCc1csc(Nc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C19H19N3O5S2/c1-12-3-5-13(6-4-12)21-19-22-14(11-28-19)10-27-18(23)16-9-15(29(20,24)25)7-8-17(16)26-2/h3-9,11H,10H2,1-2H3,(H,21,22)(H2,20,24,25) |
| InChIKey | NUOOPXUAMTVMAC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |