C20H20N2O4S — CID 7486994
[2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2,5-dimethoxybenzoate (PubChem CID 7486994) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2,5-dimethoxybenzoate.
| Compound Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7486994 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2,5-dimethoxybenzoate |
| SMILES | COc1ccc(OC)c(C(=O)OCc2csc(Nc3ccc(C)cc3)n2)c1 |
| InChI | InChI=1S/C20H20N2O4S/c1-13-4-6-14(7-5-13)21-20-22-15(12-27-20)11-26-19(23)17-10-16(24-2)8-9-18(17)25-3/h4-10,12H,11H2,1-3H3,(H,21,22) |
| InChIKey | CSTUROAHFQUAEC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |