C18H15BrN2O2S — CID 7662860
[2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-bromobenzoate (PubChem CID 7662860) has the molecular formula C18H15BrN2O2S and a molecular weight of 403.30 g/mol. Its IUPAC name is [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-bromobenzoate.
| Compound Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-bromobenzoate |
|---|---|
| PubChem CID | 7662860 |
| Molecular Formula | C18H15BrN2O2S |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-bromobenzoate |
| SMILES | Cc1ccc(Nc2nc(COC(=O)c3cccc(Br)c3)cs2)cc1 |
| InChI | InChI=1S/C18H15BrN2O2S/c1-12-5-7-15(8-6-12)20-18-21-16(11-24-18)10-23-17(22)13-3-2-4-14(19)9-13/h2-9,11H,10H2,1H3,(H,20,21) |
| InChIKey | QCRSTBPRKUYZAG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |