C20H21N3O3S — CID 27377933
2-[2-(2,5-dimethoxyanilino)-1,3-thiazol-4-yl]-N-(4-methylphenyl)acetamide (PubChem CID 27377933) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyanilino)-1,3-thiazol-4-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-(2,5-dimethoxyanilino)-1,3-thiazol-4-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 27377933 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[2-(2,5-dimethoxyanilino)-1,3-thiazol-4-yl]-N-(4-methylphenyl)acetamide |
| SMILES | COc1ccc(OC)c(Nc2nc(CC(=O)Nc3ccc(C)cc3)cs2)c1 |
| InChI | InChI=1S/C20H21N3O3S/c1-13-4-6-14(7-5-13)21-19(24)10-15-12-27-20(22-15)23-17-11-16(25-2)8-9-18(17)26-3/h4-9,11-12H,10H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | RGIBVWZQEHAIJR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |