C20H20N4O2S2 — CID 3168636
N-(2-methoxyphenyl)-2-[2-[(4-methylphenyl)carbamothioylamino]-1,3-thiazol-4-yl]acetamide (PubChem CID 3168636) has the molecular formula C20H20N4O2S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[2-[(4-methylphenyl)carbamothioylamino]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-[2-[(4-methylphenyl)carbamothioylamino]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 3168636 |
| Molecular Formula | C20H20N4O2S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[2-[(4-methylphenyl)carbamothioylamino]-1,3-thiazol-4-yl]acetamide |
| SMILES | COc1ccccc1NC(=O)Cc1csc(NC(=S)Nc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C20H20N4O2S2/c1-13-7-9-14(10-8-13)21-19(27)24-20-22-15(12-28-20)11-18(25)23-16-5-3-4-6-17(16)26-2/h3-10,12H,11H2,1-2H3,(H,23,25)(H2,21,22,24,27) |
| InChIKey | QBWBWKNJWQZLKC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|