C32H22N2O2S — CID 3907572
(2-phenyl-1,3-thiazol-4-yl)methyl 2-(4-phenylphenyl)quinoline-4-carboxylate (PubChem CID 3907572) has the molecular formula C32H22N2O2S and a molecular weight of 498.61 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 2-(4-phenylphenyl)quinoline-4-carboxylate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-(4-phenylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3907572 |
| Molecular Formula | C32H22N2O2S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-(4-phenylphenyl)quinoline-4-carboxylate |
| SMILES | O=C(OCc1csc(-c2ccccc2)n1)c1cc(-c2ccc(-c3ccccc3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C32H22N2O2S/c35-32(36-20-26-21-37-31(33-26)25-11-5-2-6-12-25)28-19-30(34-29-14-8-7-13-27(28)29)24-17-15-23(16-18-24)22-9-3-1-4-10-22/h1-19,21H,20H2 |
| InChIKey | UOMDVGDEJQUSON-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |