C24H16N2O5 — CID 39811476
1,3-benzoxazol-2-ylmethyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 39811476) has the molecular formula C24H16N2O5 and a molecular weight of 412.40 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 39811476 |
| Molecular Formula | C24H16N2O5 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(OCc1nc2ccccc2o1)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C24H16N2O5/c27-22-17-11-10-16(12-18(17)23(28)26(22)13-15-6-2-1-3-7-15)24(29)30-14-21-25-19-8-4-5-9-20(19)31-21/h1-12H,13-14H2 |
| InChIKey | ZZUDQTXNAUHBQN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|