C21H16N2O4S — CID 2489718
(2-methyl-1,3-thiazol-4-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2489718) has the molecular formula C21H16N2O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-4-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (2-methyl-1,3-thiazol-4-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2489718 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (2-methyl-1,3-thiazol-4-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1nc(COC(=O)c2ccc3c(c2)C(=O)N(Cc2ccccc2)C3=O)cs1 |
| InChI | InChI=1S/C21H16N2O4S/c1-13-22-16(12-28-13)11-27-21(26)15-7-8-17-18(9-15)20(25)23(19(17)24)10-14-5-3-2-4-6-14/h2-9,12H,10-11H2,1H3 |
| InChIKey | CGXAFBHESNJEPY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|