C22H19N3O5 — CID 30591293
(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 30591293) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 30591293 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(C)c1noc(COC(=O)c2ccc3c(c2)C(=O)N(Cc2ccccc2)C3=O)n1 |
| InChI | InChI=1S/C22H19N3O5/c1-13(2)19-23-18(30-24-19)12-29-22(28)15-8-9-16-17(10-15)21(27)25(20(16)26)11-14-6-4-3-5-7-14/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | JRJBEOHCVOKIRF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|