C24H17N3O7 — CID 29443715
[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 29443715) has the molecular formula C24H17N3O7 and a molecular weight of 459.41 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 29443715 |
| Molecular Formula | C24H17N3O7 |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | [3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(-c2noc(COC(=O)c3ccc4c(c3)C(=O)N(Cc3ccco3)C4=O)n2)cc1 |
| InChI | InChI=1S/C24H17N3O7/c1-31-16-7-4-14(5-8-16)21-25-20(34-26-21)13-33-24(30)15-6-9-18-19(11-15)23(29)27(22(18)28)12-17-3-2-10-32-17/h2-11H,12-13H2,1H3 |
| InChIKey | GYTGTESFIJRBQZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 124.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|