C18H15NO7 — CID 27041622
(2-ethoxy-2-oxoethyl) 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 27041622) has the molecular formula C18H15NO7 and a molecular weight of 357.32 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (2-ethoxy-2-oxoethyl) 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 27041622 |
| Molecular Formula | C18H15NO7 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOC(=O)COC(=O)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C18H15NO7/c1-2-24-15(20)10-26-18(23)11-5-6-13-14(8-11)17(22)19(16(13)21)9-12-4-3-7-25-12/h3-8H,2,9-10H2,1H3 |
| InChIKey | DAHPIIQYWZLTJJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|