C22H22N2O8 — CID 16511089
[2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 16511089) has the molecular formula C22H22N2O8 and a molecular weight of 442.42 g/mol. Its IUPAC name is [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16511089 |
| Molecular Formula | C22H22N2O8 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C22H22N2O8/c1-2-30-19(26)6-3-9-23-18(25)13-32-22(29)14-7-8-16-17(11-14)21(28)24(20(16)27)12-15-5-4-10-31-15/h4-5,7-8,10-11H,2-3,6,9,12-13H2,1H3,(H,23,25) |
| InChIKey | LOUNYBHVRFHNNM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|