C19H14N2O6 — CID 18099878
(3-methyl-1,2-oxazol-5-yl)methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 18099878) has the molecular formula C19H14N2O6 and a molecular weight of 366.33 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3-methyl-1,2-oxazol-5-yl)methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 18099878 |
| Molecular Formula | C19H14N2O6 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1cc(COC(=O)c2ccc3c(c2)C(=O)N(Cc2ccco2)C3=O)on1 |
| InChI | InChI=1S/C19H14N2O6/c1-11-7-14(27-20-11)10-26-19(24)12-4-5-15-16(8-12)18(23)21(17(15)22)9-13-3-2-6-25-13/h2-8H,9-10H2,1H3 |
| InChIKey | WLCFCOQVMBQDNQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 102.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|