C21H10F5NO5 — CID 16511203
(2,3,4,5,6-pentafluorophenyl)methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 16511203) has the molecular formula C21H10F5NO5 and a molecular weight of 451.30 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16511203 |
| Molecular Formula | C21H10F5NO5 |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(OCc1c(F)c(F)c(F)c(F)c1F)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C21H10F5NO5/c22-14-13(15(23)17(25)18(26)16(14)24)8-32-21(30)9-3-4-11-12(6-9)20(29)27(19(11)28)7-10-2-1-5-31-10/h1-6H,7-8H2 |
| InChIKey | ZKKIMLJBBCHXBQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|